| Name |
4-(3,4-dimethoxyphenyl)-6-propyl-3,4,6,7-tetrahydro-1H-pyrrolo[3,4-d]pyrimidine-2,5-dione
|
| Molecular Formula |
C17H21N3O4
|
| Molecular Weight |
331.4
|
| Smiles |
CCCN1CC2=C(C1=O)C(c1ccc(OC)c(OC)c1)NC(=O)N2
|
CCCN1CC2=C(C1=O)C(c1ccc(OC)c(OC)c1)NC(=O)N2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.