| Name |
n-Methoxy-3-oxo-3,4-dihydro-2h-benzo[b][1,4]thiazine-6-carboxamide
|
| Molecular Formula |
C10H10N2O3S
|
| Molecular Weight |
238.27
|
| Smiles |
CONC(=O)c1ccc2c(c1)NC(=O)CS2
|
CONC(=O)c1ccc2c(c1)NC(=O)CS2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.