| Name |
(2Z)-2-(7,8-dihydro[1,3]dioxolo[4,5-g]isoquinolin-5(6H)-ylidene)-1-(3-{[4-(4-fluorophenyl)piperazin-1-yl]sulfonyl}phenyl)ethanone
|
| Molecular Formula |
C28H26FN3O5S
|
| Molecular Weight |
535.6
|
| Smiles |
O=C(C=C1NCCc2cc3c(cc21)OCO3)c1cccc(S(=O)(=O)N2CCN(c3ccc(F)cc3)CC2)c1
|
O=C(C=C1NCCc2cc3c(cc21)OCO3)c1cccc(S(=O)(=O)N2CCN(c3ccc(F)cc3)CC2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.