| Name |
3,6-dichloro-N-[4-(3,4-dimethoxyphenyl)-1,2,5-oxadiazol-3-yl]-1-benzothiophene-2-carboxamide
|
| Molecular Formula |
C19H13Cl2N3O4S
|
| Molecular Weight |
450.3
|
| Smiles |
COc1ccc(-c2nonc2NC(=O)c2sc3cc(Cl)ccc3c2Cl)cc1OC
|
COc1ccc(-c2nonc2NC(=O)c2sc3cc(Cl)ccc3c2Cl)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.