| Name |
N-(3-methoxyphenyl)-6-{[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]methyl}-1,3,5-triazine-2,4-diamine
|
| Molecular Formula |
C14H15N7OS2
|
| Molecular Weight |
361.5
|
| Smiles |
COc1cccc(Nc2nc(N)nc(CSc3nnc(C)s3)n2)c1
|
COc1cccc(Nc2nc(N)nc(CSc3nnc(C)s3)n2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.