| Name |
(Z)-10,13-dimethyl-17-oxo-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl 3-phenylacrylate
|
| Molecular Formula |
C28H34O3
|
| Molecular Weight |
418.6
|
| Smiles |
CC12CCC3C(CC=C4CC(OC(=O)C=Cc5ccccc5)CCC43C)C1CCC2=O
|
CC12CCC3C(CC=C4CC(OC(=O)C=Cc5ccccc5)CCC43C)C1CCC2=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.