| Name |
2,8-Dinitrodibenz[b,f][1,4]oxazepin-11(10H)-one
|
| Molecular Formula |
C13H7N3O6
|
| Molecular Weight |
301.21
|
| Smiles |
O=C1Nc2cc([N+](=O)[O-])ccc2Oc2ccc([N+](=O)[O-])cc21
|
O=C1Nc2cc([N+](=O)[O-])ccc2Oc2ccc([N+](=O)[O-])cc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.