| Name |
4'-Tert-butyl-3-fluoro[1,1'-biphenyl]-4-amine
|
| Molecular Formula |
C16H18FN
|
| Molecular Weight |
243.32
|
| Smiles |
CC(C)(C)c1ccc(-c2ccc(N)c(F)c2)cc1
|
CC(C)(C)c1ccc(-c2ccc(N)c(F)c2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.