| Name |
ethyl 1-{2-[(2,4-dimethoxyphenyl)amino]-2-oxoethyl}-1H-1,2,3-triazole-4-carboxylate
|
| Molecular Formula |
C15H18N4O5
|
| Molecular Weight |
334.33
|
| Smiles |
CCOC(=O)c1cn(CC(=O)Nc2ccc(OC)cc2OC)nn1
|
CCOC(=O)c1cn(CC(=O)Nc2ccc(OC)cc2OC)nn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.