| Name |
2-((6,8-dimethyl-2-neopentyl-5,7-dioxo-5,6,7,8-tetrahydropyrimido[4,5-d]pyrimidin-4-yl)thio)-N-phenethylacetamide
|
| Molecular Formula |
C23H29N5O3S
|
| Molecular Weight |
455.6
|
| Smiles |
Cn1c(=O)c2c(SCC(=O)NCCc3ccccc3)nc(CC(C)(C)C)nc2n(C)c1=O
|
Cn1c(=O)c2c(SCC(=O)NCCc3ccccc3)nc(CC(C)(C)C)nc2n(C)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.