| Name |
8-Methoxy-3,3-bis(3-methyl-2-buten-1-yl)-2,4(1H,3H)-quinolinedione
|
| Molecular Formula |
C20H25NO3
|
| Molecular Weight |
327.4
|
| Smiles |
COc1cccc2c1NC(=O)C(CC=C(C)C)(CC=C(C)C)C2=O
|
COc1cccc2c1NC(=O)C(CC=C(C)C)(CC=C(C)C)C2=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.