| Name |
N-(2-ethoxyphenyl)-3-(phenylsulfonyl)thieno[2,3-e][1,2,3]triazolo[1,5-a]pyrimidin-5-amine
|
| Molecular Formula |
C21H17N5O3S2
|
| Molecular Weight |
451.5
|
| Smiles |
CCOc1ccccc1Nc1nc2c(S(=O)(=O)c3ccccc3)nnn2c2ccsc12
|
CCOc1ccccc1Nc1nc2c(S(=O)(=O)c3ccccc3)nnn2c2ccsc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.