| Name |
4-amino-2-(ethylsulfanyl)-5-(4-fluorophenyl)-8,8-dimethyl-5,8,9,10-tetrahydropyrimido[4,5-b]quinolin-6(7H)-one
|
| Molecular Formula |
C21H23FN4OS
|
| Molecular Weight |
398.5
|
| Smiles |
CCSc1nc(N)c2c(n1)NC1=C(C(=O)CC(C)(C)C1)C2c1ccc(F)cc1
|
CCSc1nc(N)c2c(n1)NC1=C(C(=O)CC(C)(C)C1)C2c1ccc(F)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.