| Name |
6,14-Dihydropyrido[2',1':2,3]imidazo[1,5-a]pyrido[2',1':2,3]imidazo[1,5-d]pyrazine-8,16-diium bromide
|
| Molecular Formula |
C16H14Br2N4
|
| Molecular Weight |
422.12
|
| Smiles |
[Br-].[Br-].c1cc[n+]2cc3n(c2c1)Cc1c[n+]2ccccc2n1C3
|
[Br-].[Br-].c1cc[n+]2cc3n(c2c1)Cc1c[n+]2ccccc2n1C3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.