| Name |
methyl 2-(8-(3,5-dimethyl-1H-pyrazol-1-yl)-7-isobutyl-3-methyl-2,6-dioxo-2,3,6,7-tetrahydro-1H-purin-1-yl)acetate
|
| Molecular Formula |
C18H24N6O4
|
| Molecular Weight |
388.4
|
| Smiles |
COC(=O)Cn1c(=O)c2c(nc(-n3nc(C)cc3C)n2CC(C)C)n(C)c1=O
|
COC(=O)Cn1c(=O)c2c(nc(-n3nc(C)cc3C)n2CC(C)C)n(C)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.