| Name |
2-(8-(3,5-diethyl-1H-pyrazol-1-yl)-3-methyl-7-(2-methylbenzyl)-2,6-dioxo-2,3,6,7-tetrahydro-1H-purin-1-yl)acetamide
|
| Molecular Formula |
C23H27N7O3
|
| Molecular Weight |
449.5
|
| Smiles |
CCc1cc(CC)n(-c2nc3c(c(=O)n(CC(N)=O)c(=O)n3C)n2Cc2ccccc2C)n1
|
CCc1cc(CC)n(-c2nc3c(c(=O)n(CC(N)=O)c(=O)n3C)n2Cc2ccccc2C)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.