| Name |
7-(2-hydroxy-3-(m-tolyloxy)propyl)-8-mercapto-1,3-dimethyl-1H-purine-2,6(3H,7H)-dione
|
| Molecular Formula |
C17H20N4O4S
|
| Molecular Weight |
376.4
|
| Smiles |
Cc1cccc(OCC(O)Cn2c(=S)[nH]c3c2c(=O)n(C)c(=O)n3C)c1
|
Cc1cccc(OCC(O)Cn2c(=S)[nH]c3c2c(=O)n(C)c(=O)n3C)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.