| Name |
N-[3'-acetyl-1-(4-ethoxybenzyl)-5-methyl-2-oxo-1,2-dihydro-3'H-spiro[indole-3,2'-[1,3,4]thiadiazol]-5'-yl]acetamide
|
| Molecular Formula |
C23H24N4O4S
|
| Molecular Weight |
452.5
|
| Smiles |
CCOc1ccc(CN2C(=O)C3(SC(NC(C)=O)=NN3C(C)=O)c3cc(C)ccc32)cc1
|
CCOc1ccc(CN2C(=O)C3(SC(NC(C)=O)=NN3C(C)=O)c3cc(C)ccc32)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.