| Name |
2-((7-Oxo-2,3,6,7-tetrahydro-[1,4]dioxino[2,3-g]quinolin-8-yl)methylene)malononitrile
|
| Molecular Formula |
C15H9N3O3
|
| Molecular Weight |
279.25
|
| Smiles |
N#CC(C#N)=Cc1cc2cc3c(cc2[nH]c1=O)OCCO3
|
N#CC(C#N)=Cc1cc2cc3c(cc2[nH]c1=O)OCCO3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.