| Name |
4,4-Bis(trifluoromethyl)-5,5,6,6,7,7,7-heptafluoroheptyl trichlorosilane
|
| Molecular Formula |
C9H6Cl3F13Si
|
| Molecular Weight |
495.6
|
| Smiles |
FC(F)(F)C(F)(F)C(F)(F)C(CCC[Si](Cl)(Cl)Cl)(C(F)(F)F)C(F)(F)F
|
FC(F)(F)C(F)(F)C(F)(F)C(CCC[Si](Cl)(Cl)Cl)(C(F)(F)F)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.