| Name |
N-[5-(2-furylmethyl)-1,4,5,6-tetrahydro-1,3,5-triazin-2-yl]-N-(4,6,8-trimethyl-2-quinazolinyl)amine
|
| Molecular Formula |
C19H22N6O
|
| Molecular Weight |
350.4
|
| Smiles |
Cc1cc(C)c2nc(NC3=NCN(Cc4ccco4)CN3)nc(C)c2c1
|
Cc1cc(C)c2nc(NC3=NCN(Cc4ccco4)CN3)nc(C)c2c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.