| Name |
6-(1,1,2,2,2-Pentafluoroethyl)-5-(trifluoromethyl)-2,4(1H,3H)-pyrimidinedione
|
| Molecular Formula |
C7H2F8N2O2
|
| Molecular Weight |
298.09
|
| Smiles |
O=c1[nH]c(C(F)(F)C(F)(F)F)c(C(F)(F)F)c(=O)[nH]1
|
O=c1[nH]c(C(F)(F)C(F)(F)F)c(C(F)(F)F)c(=O)[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.