| Name |
5-Tert-butyl-2,3-dimethyl-1-benzofuran
|
| Molecular Formula |
C14H18O
|
| Molecular Weight |
202.29
|
| Smiles |
Cc1oc2ccc(C(C)(C)C)cc2c1C
|
Cc1oc2ccc(C(C)(C)C)cc2c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.