| Name |
1,3-Dioxane-4-acetamide, 6-(cyanomethyl)-2,2-dimethyl-N,N-diphenyl-, (4R-cis)-(9CI)
|
| Molecular Formula |
C22H24N2O3
|
| Molecular Weight |
364.4
|
| Smiles |
CC1(C)OC(CC#N)CC(CC(=O)N(c2ccccc2)c2ccccc2)O1
|
CC1(C)OC(CC#N)CC(CC(=O)N(c2ccccc2)c2ccccc2)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.