| Name |
2-(1,1-Dimethylethyl) 1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indole-2,7-dicarboxylate
|
| Molecular Formula |
C17H20N2O4
|
| Molecular Weight |
316.35
|
| Smiles |
CC(C)(C)OC(=O)N1CCc2c([nH]c3cc(C(=O)O)ccc23)C1
|
CC(C)(C)OC(=O)N1CCc2c([nH]c3cc(C(=O)O)ccc23)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.