| Name |
N'-{2-oxo-1-azatricyclo[7.3.1.0^{5,13}]trideca-5,7,9(13)-trien-7-yl}-N-[3-(2-oxopyrrolidin-1-yl)propyl]ethanediamide
|
| Molecular Formula |
C21H26N4O4
|
| Molecular Weight |
398.5
|
| Smiles |
O=C(NCCCN1CCCC1=O)C(=O)Nc1cc2c3c(c1)CCC(=O)N3CCC2
|
O=C(NCCCN1CCCC1=O)C(=O)Nc1cc2c3c(c1)CCC(=O)N3CCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.