| Name |
N-[2-({7-Chloro-3-[3-(trifluoromethyl)phenyl]-[1,2,3]triazolo[1,5-A]quinazolin-5-YL}amino)ethyl]acetamide
|
| Molecular Formula |
C20H16ClF3N6O
|
| Molecular Weight |
448.8
|
| Smiles |
CC(=O)NCCNc1nc2c(-c3cccc(C(F)(F)F)c3)nnn2c2ccc(Cl)cc12
|
CC(=O)NCCNc1nc2c(-c3cccc(C(F)(F)F)c3)nnn2c2ccc(Cl)cc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.