| Name |
5,5a(2),6,6a(2)-Tetrachloro[2,3a(2)-bipyridin]-3-ol
|
| Molecular Formula |
C10H4Cl4N2O
|
| Molecular Weight |
310.0
|
| Smiles |
Oc1cc(Cl)c(Cl)nc1-c1cnc(Cl)c(Cl)c1
|
Oc1cc(Cl)c(Cl)nc1-c1cnc(Cl)c(Cl)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.