| Name |
3,5-Diamino-6-(3,4-dichlorophenyl)-1,2,4-triazine
|
| Molecular Formula |
C9H7Cl2N5
|
| Molecular Weight |
256.09
|
| Smiles |
Nc1nnc(-c2ccc(Cl)c(Cl)c2)c(N)n1
|
Nc1nnc(-c2ccc(Cl)c(Cl)c2)c(N)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.