| Name |
8-chloro-5-((3,4-dimethylphenyl)sulfonyl)-2,3-dimethyl-5,6-dihydro-2H-2,6-methanobenzo[g][1,3]oxazocin-4(3H)-one
|
| Molecular Formula |
C21H22ClNO4S
|
| Molecular Weight |
419.9
|
| Smiles |
Cc1ccc(S(=O)(=O)C2C(=O)N(C)C3(C)CC2c2cc(Cl)ccc2O3)cc1C
|
Cc1ccc(S(=O)(=O)C2C(=O)N(C)C3(C)CC2c2cc(Cl)ccc2O3)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.