| Name |
1,6-Dimethyl-4-phenyl-1,2-dihydropyridin-2-one
|
| Molecular Formula |
C13H13NO
|
| Molecular Weight |
199.25
|
| Smiles |
Cc1cc(-c2ccccc2)cc(=O)n1C
|
Cc1cc(-c2ccccc2)cc(=O)n1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.