| Name |
N-(4-ethyl-5-oxo-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepin-7-yl)-3,3-dimethylbutanamide
|
| Molecular Formula |
C17H24N2O3
|
| Molecular Weight |
304.4
|
| Smiles |
CCN1CCOc2ccc(NC(=O)CC(C)(C)C)cc2C1=O
|
CCN1CCOc2ccc(NC(=O)CC(C)(C)C)cc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.