| Name |
N1-(4-((4-chlorophenyl)sulfonyl)-2-(2-fluorophenyl)oxazol-5-yl)-N3,N3-dimethylpropane-1,3-diamine
|
| Molecular Formula |
C20H21ClFN3O3S
|
| Molecular Weight |
437.9
|
| Smiles |
CN(C)CCCNc1oc(-c2ccccc2F)nc1S(=O)(=O)c1ccc(Cl)cc1
|
CN(C)CCCNc1oc(-c2ccccc2F)nc1S(=O)(=O)c1ccc(Cl)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.