| Name |
2,2,10,10-Tetramethyl-3,9-dioxa-2,10-disilaundecan-6-one
|
| Molecular Formula |
C11H26O3Si2
|
| Molecular Weight |
262.49
|
| Smiles |
C[Si](C)(C)OCCC(=O)CCO[Si](C)(C)C
|
C[Si](C)(C)OCCC(=O)CCO[Si](C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.