| Name |
6,8-Dibromo-7-hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid
|
| Molecular Formula |
C10H9Br2NO3
|
| Molecular Weight |
350.99
|
| Smiles |
O=C(O)C1Cc2cc(Br)c(O)c(Br)c2CN1
|
O=C(O)C1Cc2cc(Br)c(O)c(Br)c2CN1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.