| Name |
4,4',4'',4'''-(Adamantane-1,3,5,7-tetrayl)tetrabenzoic acid
|
| Molecular Formula |
C38H32O8
|
| Molecular Weight |
616.7
|
| Smiles |
O=C(O)c1ccc(C23CC4(c5ccc(C(=O)O)cc5)CC(c5ccc(C(=O)O)cc5)(C2)CC(c2ccc(C(=O)O)cc2)(C3)C4)cc1
|
O=C(O)c1ccc(C23CC4(c5ccc(C(=O)O)cc5)CC(c5ccc(C(=O)O)cc5)(C2)CC(c2ccc(C(=O)O)cc2)(C3)C4)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.