| Name |
1-(2-(3,4-dichlorophenyl)-2-oxoethyl)-3-(pyridin-4-ylmethyl)pyrido[3,2-d]pyrimidine-2,4(1H,3H)-dione
|
| Molecular Formula |
C21H14Cl2N4O3
|
| Molecular Weight |
441.3
|
| Smiles |
O=C(Cn1c(=O)n(Cc2ccncc2)c(=O)c2ncccc21)c1ccc(Cl)c(Cl)c1
|
O=C(Cn1c(=O)n(Cc2ccncc2)c(=O)c2ncccc21)c1ccc(Cl)c(Cl)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.