| Name |
Lup-20(29)-en-3-ol, 3-(hydrogen butanedioate), (3I(2))-
|
| Molecular Formula |
C34H54O4
|
| Molecular Weight |
526.8
|
| Smiles |
C=C(C)C1CCC2(C)CCC3(C)C(CCC4C5(C)CCC(OC(=O)CCC(=O)O)C(C)(C)C5CCC43C)C12
|
C=C(C)C1CCC2(C)CCC3(C)C(CCC4C5(C)CCC(OC(=O)CCC(=O)O)C(C)(C)C5CCC43C)C12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.