| Name |
2-((3-butyl-4-oxo-3,4-dihydrobenzofuro[3,2-d]pyrimidin-2-yl)thio)-N-(2-chlorophenyl)acetamide
|
| Molecular Formula |
C22H20ClN3O3S
|
| Molecular Weight |
441.9
|
| Smiles |
CCCCn1c(SCC(=O)Nc2ccccc2Cl)nc2c(oc3ccccc32)c1=O
|
CCCCn1c(SCC(=O)Nc2ccccc2Cl)nc2c(oc3ccccc32)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.