| Name |
N-(3-chlorophenyl)-2-{[3-(3-methylbutyl)-4-oxo-3,4-dihydro[1]benzofuro[3,2-d]pyrimidin-2-yl]sulfanyl}acetamide
|
| Molecular Formula |
C23H22ClN3O3S
|
| Molecular Weight |
456.0
|
| Smiles |
CC(C)CCn1c(SCC(=O)Nc2cccc(Cl)c2)nc2c(oc3ccccc32)c1=O
|
CC(C)CCn1c(SCC(=O)Nc2cccc(Cl)c2)nc2c(oc3ccccc32)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.