| Name |
[(4S,6S,7R,8S)-11-amino-5-[5-[(4S,6S,7R,8S)-11-amino-8-(carbamoyloxymethyl)-7-methoxy-12-methyl-10,13-dioxo-2,5-diazatetracyclo[7.4.0.02,7.04,6]trideca-1(9),11-dien-5-yl]-5-oxopentanoyl]-7-methoxy-12-methyl-10,13-dioxo-2,5-diazatetracyclo[7.4.0.02,7.04,6]trideca-1(9),11-dien-8-yl]methyl carbamate
|
| Molecular Formula |
C35H40N8O12
|
| Molecular Weight |
764.7
|
| Smiles |
COC12C(COC(N)=O)C3=C(C(=O)C(C)=C(N)C3=O)N1CC1C2N1C(=O)CCCC(=O)N1C2CN3C4=C(C(=O)C(N)=C(C)C4=O)C(COC(N)=O)C3(OC)C21
|
COC12C(COC(N)=O)C3=C(C(=O)C(C)=C(N)C3=O)N1CC1C2N1C(=O)CCCC(=O)N1C2CN3C4=C(C(=O)C(N)=C(C)C4=O)C(COC(N)=O)C3(OC)C21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.