| Name |
(3aS,6R,6aR,9bS)-6-hydroxy-6,9-dimethyl-3-methylene-3a,4,5,6,6a,7-hexahydroazuleno[4,5-b]furan-2,8(3H,9bH)-dione
|
| Molecular Formula |
C15H18O4
|
| Molecular Weight |
262.30
|
| Smiles |
C=C1C(=O)OC2C3=C(C)C(=O)CC3C(C)(O)CCC12
|
C=C1C(=O)OC2C3=C(C)C(=O)CC3C(C)(O)CCC12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.