| Name |
N--BOC--(4S,3R)-2,2-difluorostatine ethyl ester
|
| Molecular Formula |
C15H27F2NO5
|
| Molecular Weight |
339.37
|
| Smiles |
CCOC(=O)C(F)(F)C(O)C(CC(C)C)NC(=O)OC(C)(C)C
|
CCOC(=O)C(F)(F)C(O)C(CC(C)C)NC(=O)OC(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.