| Name |
1-(4-ethylphenyl)-1H,4H,5H,6H-cyclopenta[c]pyrazole-3-carboxylic acid
|
| Molecular Formula |
C15H16N2O2
|
| Molecular Weight |
256.30
|
| Smiles |
CCc1ccc(-n2nc(C(=O)O)c3c2CCC3)cc1
|
CCc1ccc(-n2nc(C(=O)O)c3c2CCC3)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.