| Name |
N-(2-methoxyethyl)-2-{3-[2-(thiophen-2-yl)acetamido]-2H,4H,6H-thieno[3,4-c]pyrazol-2-yl}acetamide
|
| Molecular Formula |
C16H20N4O3S2
|
| Molecular Weight |
380.5
|
| Smiles |
COCCNC(=O)Cn1nc2c(c1NC(=O)Cc1cccs1)CSC2
|
COCCNC(=O)Cn1nc2c(c1NC(=O)Cc1cccs1)CSC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.