| Name |
Thieno[2,3-b]pyridin-6(7H)-one, 2,4-dichloro-7-methyl-
|
| Molecular Formula |
C8H5Cl2NOS
|
| Molecular Weight |
234.10
|
| Smiles |
Cn1c(=O)cc(Cl)c2cc(Cl)sc21
|
Cn1c(=O)cc(Cl)c2cc(Cl)sc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.