| Name |
4,9-Dihydrobenzo[1,2-d:4,5-d']bis([1,3]dioxine)-2,7-dione
|
| Molecular Formula |
C10H6O6
|
| Molecular Weight |
222.15
|
| Smiles |
O=C1OCc2cc3c(cc2O1)COC(=O)O3
|
O=C1OCc2cc3c(cc2O1)COC(=O)O3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.