| Name |
8-Chloro-2,3-dihydropyrrolo[1,2-d][1,2,4]triazine-1,4-dione
|
| Molecular Formula |
C6H4ClN3O2
|
| Molecular Weight |
185.57
|
| Smiles |
O=c1[nH][nH]c(=O)n2ccc(Cl)c12
|
O=c1[nH][nH]c(=O)n2ccc(Cl)c12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.