| Name |
3,5,7,8-Tetrachloro-perfluorooctanoic acid-1-phenylmethanamine (1:1)
|
| Molecular Formula |
C15H10Cl4F11NO2
|
| Molecular Weight |
587.0
|
| Smiles |
NCc1ccccc1.O=C(O)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)Cl
|
NCc1ccccc1.O=C(O)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.