| Name |
Rel-(3aR,6s,8aS)-N,N,2,2-tetramethyl-4,4,8,8-tetraphenyltetrahydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepin-6-amine
|
| Molecular Formula |
C33H34NO4P
|
| Molecular Weight |
539.6
|
| Smiles |
CN(C)P1OC(c2ccccc2)(c2ccccc2)C2OC(C)(C)OC2C(c2ccccc2)(c2ccccc2)O1
|
CN(C)P1OC(c2ccccc2)(c2ccccc2)C2OC(C)(C)OC2C(c2ccccc2)(c2ccccc2)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.